Compound Q&A

What is (2R,3R)-3-[(1R)-1-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}ethyl]-4-oxo-2-azetidinyl acetate (CAS: 76855-69-1)?

Answer

(2R,3R)-3-[(1R)-1-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}ethyl]-4-oxo-2-azetidinyl acetate
This compound, with the CAS number 76855-69-1, is a synthetic organic molecule characterized by its complex structure containing an azetidine ring and an ester group. It is known for its potential biological activity and is often used in pharmaceutical research for its structural versatility and reactivity. The molecular formula is C12H22O5Si, and it typically appears as a white to off-white solid with a relatively high molecular weight.

About

CAS No 76855-69-1
English Name (2R,3R)-3-[(1R)-1-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}ethyl]-4-oxo-2-azetidinyl acetate
Molecular Formula C13H25NO4Si
Molecular Weight 287.432 g/mol
SMILES CC(C1C(NC1=O)OC(=O)C)O[Si](C)(C)C(C)(C)C
InChIKey GWHDKFODLYVMQG-UBHAPETDSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (2R,3R)-3-[(1R)-1-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}ethyl]-4-oxo-2-azetidinyl acetate (CAS: 76855-69-1)?

This compound is primarily used in pharmaceutical research as a building block for drug development,...

Compound Q&A

Is (2R,3R)-3-[(1R)-1-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}ethyl]-4-oxo-2-azetidinyl acetate (CAS: 76855-69-1) safe?

Safety of this compound depends on its application and exposure conditions. It is generally consider...

Compound Q&A

How should (2R,3R)-3-[(1R)-1-{[Dimethyl(2-methyl-2-propanyl)silyl]oxy}ethyl]-4-oxo-2-azetidinyl acetate (CAS: 76855-69-1) be stored?

This compound should be stored in a cool, dry, and well-ventilated area, away from direct light. It ...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...