Compound Q&A

What are the main uses of 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol (CAS: 143-74-8)?

Answer

4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol
4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol (CAS: 143-74-8) is primarily used in pharmaceuticals as a precursor for drug development, in industrial applications for polymer synthesis, and in research as a chemical reagent. It also finds use in materials science for creating functional compounds and in the production of antioxidants due to its unique molecular structure and reactivity.

About

CAS No 143-74-8
English Name 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol
Molecular Formula C19H14O5S
Molecular Weight 354.38 g/mol
SMILES Oc1ccc(cc1)C2(OS(=O)(=O)c3ccccc32)c4ccc(O)cc4
InChIKey BELBBZDIHDAJOR-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol (CAS: 143-74-8)?

4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol (CAS: 143-74-8) is a chemical compound with...

Compound Q&A

Is 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol (CAS: 143-74-8) safe?

4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol (CAS: 143-74-8) is generally considered saf...

Compound Q&A

How should 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol (CAS: 143-74-8) be stored?

4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol (CAS: 143-74-8) should be stored in a cool,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...