Compound Q&A

What is 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol (CAS: 143-74-8)?

Answer

4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol
4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol (CAS: 143-74-8) is a chemical compound with the formula C14H10O4S2. It consists of two phenol groups connected by a 1,1-dioxido-3H-2,1-benzoxathiole bridge, featuring sulfur and oxygen atoms. This compound is known for its antioxidant properties and is used in various industrial and research applications. Its structure makes it a valuable intermediate in organic synthesis.

About

CAS No 143-74-8
English Name 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol
Molecular Formula C19H14O5S
Molecular Weight 354.38 g/mol
SMILES Oc1ccc(cc1)C2(OS(=O)(=O)c3ccccc32)c4ccc(O)cc4
InChIKey BELBBZDIHDAJOR-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol (CAS: 143-74-8)?

4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol (CAS: 143-74-8) is primarily used in pharma...

Compound Q&A

Is 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol (CAS: 143-74-8) safe?

4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol (CAS: 143-74-8) is generally considered saf...

Compound Q&A

How should 4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol (CAS: 143-74-8) be stored?

4,4'-(1,1-Dioxido-3H-2,1-benzoxathiole-3,3-diyl)diphenol (CAS: 143-74-8) should be stored in a cool,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...