Compound Q&A

What are the main uses of 6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 91-53-2)?

Answer

6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline
6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 91-53-2) is primarily used in pharmaceutical research as a precursor for drug development. It also finds applications in organic synthesis and industrial chemistry, where its structural features make it valuable for creating complex molecules. Additionally, it is used in research settings for studying biological activity and chemical reactivity.

About

CAS No 91-53-2
English Name 6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline
Molecular Formula C14H19NO
Molecular Weight 217.31 g/mol
SMILES CCOc1ccc2NC(C)(C)C=C(C)c2c1
InChIKey DECIPOUIJURFOJ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 91-53-2)?

6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 91-53-2) is a chemical compound with the molecul...

Compound Q&A

Is 6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 91-53-2) safe?

6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 91-53-2) is generally considered safe when handl...

Compound Q&A

How should 6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 91-53-2) be stored?

6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 91-53-2) should be stored in a cool, dry, and we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...