Compound Q&A

What is 6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 91-53-2)?

Answer

6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline
6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 91-53-2) is a chemical compound with the molecular formula C14H19NO. It is a derivative of quinoline, characterized by the presence of an ethoxy group and three methyl groups. This compound is known for its aromatic structure and is commonly used in various chemical applications due to its unique properties.

About

CAS No 91-53-2
English Name 6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline
Molecular Formula C14H19NO
Molecular Weight 217.31 g/mol
SMILES CCOc1ccc2NC(C)(C)C=C(C)c2c1
InChIKey DECIPOUIJURFOJ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 91-53-2)?

6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 91-53-2) is primarily used in pharmaceutical res...

Compound Q&A

Is 6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 91-53-2) safe?

6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 91-53-2) is generally considered safe when handl...

Compound Q&A

How should 6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 91-53-2) be stored?

6-Ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline (CAS: 91-53-2) should be stored in a cool, dry, and we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...