Compound Q&A

How should N,N,N-Tributyl-1-butanaminium fluoride (CAS: 429-41-4) be stored?

Answer

N,N,N-Tributyl-1-butanaminium fluoride
N,N,N-Tributyl-1-butanaminium fluoride (CAS: 429-41-4) should be stored in a cool, dry, and well-ventilated area away from moisture and light. It is typically kept in airtight containers made of polyethylene or glass to prevent contamination. Avoid exposure to heat and ensure proper labeling for safe storage and handling.

About

CAS No 429-41-4
English Name N,N,N-Tributyl-1-butanaminium fluoride
Molecular Formula C16H36FN
Molecular Weight 261.46 g/mol
SMILES CCCC[N+](CCCC)(CCCC)CCCC.[F-]
InChIKey FPGGTKZVZWFYPV-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is N,N,N-Tributyl-1-butanaminium fluoride (CAS: 429-41-4)?

N,N,N-Tributyl-1-butanaminium fluoride (CAS: 429-41-4) is a quaternary ammonium fluoride salt. It ha...

Compound Q&A

What are the main uses of N,N,N-Tributyl-1-butanaminium fluoride (CAS: 429-41-4)?

N,N,N-Tributyl-1-butanaminium fluoride (CAS: 429-41-4) is primarily used as a catalyst in pharmaceut...

Compound Q&A

Is N,N,N-Tributyl-1-butanaminium fluoride (CAS: 429-41-4) safe?

N,N,N-Tributyl-1-butanaminium fluoride (CAS: 429-41-4) is generally considered safe when handled pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...