Compound Q&A

What are the main uses of N,N,N-Tributyl-1-butanaminium fluoride (CAS: 429-41-4)?

Answer

N,N,N-Tributyl-1-butanaminium fluoride
N,N,N-Tributyl-1-butanaminium fluoride (CAS: 429-41-4) is primarily used as a catalyst in pharmaceutical and industrial applications. It is effective in promoting reactions such as nucleophilic substitutions and can be found in the production of various organic compounds. Its utility extends to research settings for synthetic chemistry and functional group transformations.

About

CAS No 429-41-4
English Name N,N,N-Tributyl-1-butanaminium fluoride
Molecular Formula C16H36FN
Molecular Weight 261.46 g/mol
SMILES CCCC[N+](CCCC)(CCCC)CCCC.[F-]
InChIKey FPGGTKZVZWFYPV-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is N,N,N-Tributyl-1-butanaminium fluoride (CAS: 429-41-4)?

N,N,N-Tributyl-1-butanaminium fluoride (CAS: 429-41-4) is a quaternary ammonium fluoride salt. It ha...

Compound Q&A

Is N,N,N-Tributyl-1-butanaminium fluoride (CAS: 429-41-4) safe?

N,N,N-Tributyl-1-butanaminium fluoride (CAS: 429-41-4) is generally considered safe when handled pro...

Compound Q&A

How should N,N,N-Tributyl-1-butanaminium fluoride (CAS: 429-41-4) be stored?

N,N,N-Tributyl-1-butanaminium fluoride (CAS: 429-41-4) should be stored in a cool, dry, and well-ven...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...