Compound Q&A

Is (9Z)-9-Octadecenimidic acid (CAS: 301-02-0) safe?

Answer

(9Z)-9-Octadecenimidic acid
(9Z)-9-Octadecenimidic acid (CAS: 301-02-0) is generally considered safe when handled properly. However, as with many chemical compounds, it should be used with appropriate safety measures, such as wearing protective gloves and goggles. It is not classified as highly toxic but may require careful handling in industrial and laboratory settings.

About

CAS No 301-02-0
English Name (9Z)-9-Octadecenimidic acid
Molecular Formula C18H35NO
Molecular Weight 281.48 g/mol
SMILES CCCCCCCC/C=C\CCCCCCCC(N)=O
InChIKey FATBGEAMYMYZAF-KTKRTIGZSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (9Z)-9-Octadecenimidic acid (CAS: 301-02-0)?

(9Z)-9-Octadecenimidic acid, with the CAS number 301-02-0, is an organic compound containing an imid...

Compound Q&A

What are the main uses of (9Z)-9-Octadecenimidic acid (CAS: 301-02-0)?

(9Z)-9-Octadecenimidic acid (CAS: 301-02-0) is primarily used in the synthesis of various pharmaceut...

Compound Q&A

How should (9Z)-9-Octadecenimidic acid (CAS: 301-02-0) be stored?

(9Z)-9-Octadecenimidic acid (CAS: 301-02-0) should be stored in a cool, dry, and well-ventilated pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...