Compound Q&A

What is (9Z)-9-Octadecenimidic acid (CAS: 301-02-0)?

Answer

(9Z)-9-Octadecenimidic acid
(9Z)-9-Octadecenimidic acid, with the CAS number 301-02-0, is an organic compound containing an imidic acid functional group and a long hydrocarbon chain. It is characterized by its Z configuration at the double bond and is commonly used in chemical research and pharmaceutical applications due to its structural versatility.

About

CAS No 301-02-0
English Name (9Z)-9-Octadecenimidic acid
Molecular Formula C18H35NO
Molecular Weight 281.48 g/mol
SMILES CCCCCCCC/C=C\CCCCCCCC(N)=O
InChIKey FATBGEAMYMYZAF-KTKRTIGZSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (9Z)-9-Octadecenimidic acid (CAS: 301-02-0)?

(9Z)-9-Octadecenimidic acid (CAS: 301-02-0) is primarily used in the synthesis of various pharmaceut...

Compound Q&A

Is (9Z)-9-Octadecenimidic acid (CAS: 301-02-0) safe?

(9Z)-9-Octadecenimidic acid (CAS: 301-02-0) is generally considered safe when handled properly. Howe...

Compound Q&A

How should (9Z)-9-Octadecenimidic acid (CAS: 301-02-0) be stored?

(9Z)-9-Octadecenimidic acid (CAS: 301-02-0) should be stored in a cool, dry, and well-ventilated pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...