Compound Q&A

What is N,O-Bis(trimethylsilyl) Acetamide (CAS: 10416-59-8)?

Answer

N,O-Bis(trimethylsilyl) Acetamide
N,O-Bis(trimethylsilyl) Acetamide is a silylating agent with the chemical formula C6H16N2OSi2. It is a white solid that is commonly used in organic synthesis due to its ability to protect amino groups. The compound is known for its stability and low reactivity under normal conditions, making it a valuable tool in chemical research.

About

CAS No 10416-59-8
English Name N,O-Bis(trimethylsilyl) Acetamide
Molecular Formula C8H21NOSi2
Molecular Weight 203.43 g/mol
SMILES CC(=N[Si](C)(C)C)O[Si](C)(C)C
InChIKey SIOVKLKJSOKLIF-CMDGGOBGSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of N,O-Bis(trimethylsilyl) Acetamide (CAS: 10416-59-8)?

N,O-Bis(trimethylsilyl) Acetamide is primarily used in pharmaceutical and chemical research for prot...

Compound Q&A

Is N,O-Bis(trimethylsilyl) Acetamide (CAS: 10416-59-8) safe?

N,O-Bis(trimethylsilyl) Acetamide is generally considered safe when handled properly. However, it sh...

Compound Q&A

How should N,O-Bis(trimethylsilyl) Acetamide (CAS: 10416-59-8) be stored?

N,O-Bis(trimethylsilyl) Acetamide should be stored in a cool, dry, and dark place, ideally at 2-8°C....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...