Compound Q&A

What are the main uses of 3,5-Dinitrobenzoic acid (CAS: 99-34-3)?

Answer

3,5-Dinitrobenzoic acid
3,5-Dinitrobenzoic acid (CAS: 99-34-3) is widely used in pharmaceuticals as an intermediate for drug synthesis. It also finds applications in the dye industry, where it is used to produce azo dyes. Additionally, it serves as a reagent in research for organic synthesis and analytical chemistry. Its properties make it valuable in the development of various chemical products and materials.

About

CAS No 99-34-3
English Name 3,5-Dinitrobenzoic acid
Molecular Formula C7H4N2O6
Molecular Weight 212.12 g/mol
SMILES C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)O
InChIKey VYWYYJYRVSBHJQ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 3,5-Dinitrobenzoic acid (CAS: 99-34-3)?

3,5-Dinitrobenzoic acid (CAS: 99-34-3) is an organic compound with the chemical formula C7H5N2O5. It...

Compound Q&A

Is 3,5-Dinitrobenzoic acid (CAS: 99-34-3) safe?

3,5-Dinitrobenzoic acid (CAS: 99-34-3) is considered hazardous due to its toxic and corrosive proper...

Compound Q&A

How should 3,5-Dinitrobenzoic acid (CAS: 99-34-3) be stored?

3,5-Dinitrobenzoic acid (CAS: 99-34-3) should be stored in a cool, dry, and dark place to maintain i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...