Compound Q&A

What is 3,5-Dinitrobenzoic acid (CAS: 99-34-3)?

Answer

3,5-Dinitrobenzoic acid
3,5-Dinitrobenzoic acid (CAS: 99-34-3) is an organic compound with the chemical formula C7H5N2O5. It is a yellow crystalline solid that is commonly used in various chemical applications. The compound exhibits strong acidic properties due to the carboxylic acid group and has two nitro groups attached to the benzene ring, contributing to its high reactivity and oxidizing nature.

About

CAS No 99-34-3
English Name 3,5-Dinitrobenzoic acid
Molecular Formula C7H4N2O6
Molecular Weight 212.12 g/mol
SMILES C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)O
InChIKey VYWYYJYRVSBHJQ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 3,5-Dinitrobenzoic acid (CAS: 99-34-3)?

3,5-Dinitrobenzoic acid (CAS: 99-34-3) is widely used in pharmaceuticals as an intermediate for drug...

Compound Q&A

Is 3,5-Dinitrobenzoic acid (CAS: 99-34-3) safe?

3,5-Dinitrobenzoic acid (CAS: 99-34-3) is considered hazardous due to its toxic and corrosive proper...

Compound Q&A

How should 3,5-Dinitrobenzoic acid (CAS: 99-34-3) be stored?

3,5-Dinitrobenzoic acid (CAS: 99-34-3) should be stored in a cool, dry, and dark place to maintain i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...