Compound Q&A

How should 1-Adamantanecarboxylic acid (CAS: 828-51-3) be stored?

Answer

1-Adamantanecarboxylic acid
1-Adamantanecarboxylic acid should be stored in a cool, dry, and well-ventilated area, away from light and moisture. It is typically kept in a sealed container made of glass or polyethylene to prevent degradation. Storage conditions should maintain a temperature below 25°C and humidity levels below 60% to ensure long-term stability and safety.

About

CAS No 828-51-3
English Name 1-Adamantanecarboxylic acid
Molecular Formula C11H16O2
Molecular Weight 180.25 g/mol
SMILES C1C2CC3CC1CC(C2)(C3)C(=O)O
InChIKey JIMXXGFJRDUSRO-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 1-Adamantanecarboxylic acid (CAS: 828-51-3)?

1-Adamantanecarboxylic acid is a cyclic organic compound with the chemical formula C10H16O2. It belo...

Compound Q&A

What are the main uses of 1-Adamantanecarboxylic acid (CAS: 828-51-3)?

1-Adamantanecarboxylic acid is primarily used in pharmaceutical research as a building block for dru...

Compound Q&A

Is 1-Adamantanecarboxylic acid (CAS: 828-51-3) safe?

1-Adamantanecarboxylic acid is generally considered safe when handled properly, but it should be tre...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...