Compound Q&A

What is 1-Adamantanecarboxylic acid (CAS: 828-51-3)?

Answer

1-Adamantanecarboxylic acid
1-Adamantanecarboxylic acid is a cyclic organic compound with the chemical formula C10H16O2. It belongs to the class of carboxylic acids and is characterized by its adamantane ring structure, which provides unique physical and chemical stability. This compound is known for its low solubility in water and high melting point, making it useful in various specialized applications.

About

CAS No 828-51-3
English Name 1-Adamantanecarboxylic acid
Molecular Formula C11H16O2
Molecular Weight 180.25 g/mol
SMILES C1C2CC3CC1CC(C2)(C3)C(=O)O
InChIKey JIMXXGFJRDUSRO-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 1-Adamantanecarboxylic acid (CAS: 828-51-3)?

1-Adamantanecarboxylic acid is primarily used in pharmaceutical research as a building block for dru...

Compound Q&A

Is 1-Adamantanecarboxylic acid (CAS: 828-51-3) safe?

1-Adamantanecarboxylic acid is generally considered safe when handled properly, but it should be tre...

Compound Q&A

How should 1-Adamantanecarboxylic acid (CAS: 828-51-3) be stored?

1-Adamantanecarboxylic acid should be stored in a cool, dry, and well-ventilated area, away from lig...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...