Compound Q&A

How should 2-[(5-Nitro-1,3-thiazol-2-yl)carbamoyl]phenyl acetate (CAS: 55981-09-4) be stored?

Answer

2-[(5-Nitro-1,3-thiazol-2-yl)carbamoyl]phenyl acetate
2-[(5-Nitro-1,3-thiazol-2-yl)carbamoyl]phenyl acetate (CAS: 55981-09-4) should be stored in a cool, dry, and well-ventilated area, away from direct light. It is typically kept in airtight containers to prevent moisture ingress and maintain chemical stability. Proper storage conditions are essential to preserve its properties and ensure safe handling during use.

About

CAS No 55981-09-4
English Name 2-[(5-Nitro-1,3-thiazol-2-yl)carbamoyl]phenyl acetate
Molecular Formula C12H9N3O5S
Molecular Weight 307.2820 g/mol
SMILES CC(=O)Oc1ccccc1C(=O)Nc2ncc(s2)[N+](=O)[O-]
InChIKey YQNQNVDNTFHQSW-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-[(5-Nitro-1,3-thiazol-2-yl)carbamoyl]phenyl acetate (CAS: 55981-09-4)?

2-[(5-Nitro-1,3-thiazol-2-yl)carbamoyl]phenyl acetate is a chemical compound with the CAS number 559...

Compound Q&A

What are the main uses of 2-[(5-Nitro-1,3-thiazol-2-yl)carbamoyl]phenyl acetate (CAS: 55981-09-4)?

2-[(5-Nitro-1,3-thiazol-2-yl)carbamoyl]phenyl acetate (CAS: 55981-09-4) is primarily used in pharmac...

Compound Q&A

Is 2-[(5-Nitro-1,3-thiazol-2-yl)carbamoyl]phenyl acetate (CAS: 55981-09-4) safe?

Safety of 2-[(5-Nitro-1,3-thiazol-2-yl)carbamoyl]phenyl acetate (CAS: 55981-09-4) depends on its han...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...