Compound Q&A

What are the main uses of (2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) (CAS: 2743-38-6)?

Answer

(2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1)
This compound is primarily used in pharmaceutical research as a precursor for drug development, particularly in the synthesis of anti-inflammatory agents. It also serves as an intermediate in organic chemistry for creating complex molecules and is utilized in polymer science to modify material properties. Its applications extend to laboratory settings for analytical and structural studies due to its reactivity and solubility characteristics.

About

CAS No 2743-38-6
English Name (2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1)
Molecular Formula C18H16O9
Molecular Weight 358.3 g/mol
SMILES OC(=O)[C@@H]([C@H](C(=O)O)OC(=O)c1ccccc1)OC(=O)c1ccccc1
InChIKey DXDIHODZARUBLA-DTPOWOMPSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) (CAS: 2743-38-6)?

(2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) is a crystalline organic compound with the C...

Compound Q&A

Is (2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) (CAS: 2743-38-6) safe?

(2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) is generally considered safe when handled pr...

Compound Q&A

How should (2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) (CAS: 2743-38-6) be stored?

Store (2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) (CAS: 2743-38-6) in a cool, dry place (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...