Compound Q&A

What is (2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) (CAS: 2743-38-6)?

Answer

(2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1)
(2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) is a crystalline organic compound with the CAS number 2743-38-6. It features two benzoyloxy groups attached to the succinic acid backbone, with a 1:1 hydration ratio. The compound is known for its stability in aqueous environments and is commonly used in specialized chemical applications due to its unique molecular structure and functional groups.

About

CAS No 2743-38-6
English Name (2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1)
Molecular Formula C18H16O9
Molecular Weight 358.3 g/mol
SMILES OC(=O)[C@@H]([C@H](C(=O)O)OC(=O)c1ccccc1)OC(=O)c1ccccc1
InChIKey DXDIHODZARUBLA-DTPOWOMPSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) (CAS: 2743-38-6)?

This compound is primarily used in pharmaceutical research as a precursor for drug development, part...

Compound Q&A

Is (2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) (CAS: 2743-38-6) safe?

(2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) is generally considered safe when handled pr...

Compound Q&A

How should (2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) (CAS: 2743-38-6) be stored?

Store (2R,3R)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) (CAS: 2743-38-6) in a cool, dry place (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...