Compound Q&A

What are the main uses of (2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid (CAS: 18449-41-7)?

Answer

(2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid
(2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid is primarily used in pharmaceutical research for its potential anti-inflammatory and antioxidant properties. It also finds applications in natural product chemistry and may be used as a precursor in the synthesis of other bioactive compounds. Its use in food and industry is limited due to low availability and specific handling requirements.

About

CAS No 18449-41-7
English Name (2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid
Molecular Formula C30H48O6
Molecular Weight 504.71 g/mol
SMILES C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(C[C@H]([C@@H]5[C@@]4(C[C@H]([C@@H]([C@@]5(C)CO)O)O)C)O)C)[C@@H]2[C@H]1C)C)C(=O)O
InChIKey PRAUVHZJPXOEIF-AOLYGAPISA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid (CAS: 18449-41-7)?

(2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid, with CAS number 18449-41-7, is a n...

Compound Q&A

Is (2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid (CAS: 18449-41-7) safe?

(2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid is generally considered safe when h...

Compound Q&A

How should (2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid (CAS: 18449-41-7) be stored?

(2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid should be stored in a cool, dry, an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...