Compound Q&A

What is (2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid (CAS: 18449-41-7)?

Answer

(2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid
(2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid, with CAS number 18449-41-7, is a naturally occurring pentacyclic triterpenoid compound. It belongs to the ursane skeleton family and is commonly found in certain plants. This compound exhibits various physicochemical properties such as solubility in organic solvents and has a molecular formula of C30H52O7.

About

CAS No 18449-41-7
English Name (2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid
Molecular Formula C30H48O6
Molecular Weight 504.71 g/mol
SMILES C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(C[C@H]([C@@H]5[C@@]4(C[C@H]([C@@H]([C@@]5(C)CO)O)O)C)O)C)[C@@H]2[C@H]1C)C)C(=O)O
InChIKey PRAUVHZJPXOEIF-AOLYGAPISA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid (CAS: 18449-41-7)?

(2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid is primarily used in pharmaceutical...

Compound Q&A

Is (2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid (CAS: 18449-41-7) safe?

(2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid is generally considered safe when h...

Compound Q&A

How should (2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid (CAS: 18449-41-7) be stored?

(2alpha,3beta,6beta)-2,3,6,23-Tetrahydroxyurs-12-en-28-oic acid should be stored in a cool, dry, an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...