Compound Q&A

Is (2R,3R)-2,3-Dihydroxysuccinic acid - 2-{[(3aR,4S,6R,6aS)-6-amino-2,2-dimethyltetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy}ethanol (1:1) (CAS: 376608-65-0) safe?

Answer

(2R,3R)-2,3-Dihydroxysuccinic acid - 2-{[(3aR,4S,6R,6aS)-6-amino-2,2-dimethyltetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy}ethanol (1:1)
The safety of this compound depends on its handling and exposure conditions. It is generally considered safe when used in controlled laboratory environments, but proper protective measures such as gloves and ventilation should be taken. Safety data sheets (SDS) should be consulted for specific handling guidelines and potential health risks.

About

English Name (2R,3R)-2,3-Dihydroxysuccinic acid - 2-{[(3aR,4S,6R,6aS)-6-amino-2,2-dimethyltetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy}ethanol (1:1)
Molecular Formula C14H25NO10
Molecular Weight 367.35 g/mol
SMILES CC1(C)O[C@H]2[C@H](N)C[C@H](OCCO)[C@H]2O1.O[C@H]([C@@H](O)C(=O)O)C(=O)O
InChIKey XEYNXCGNMKWIDO-ABGQOWMBSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (2R,3R)-2,3-Dihydroxysuccinic acid - 2-{[(3aR,4S,6R,6aS)-6-amino-2,2-dimethyltetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy}ethanol (1:1) (CAS: 376608-65-0)?

This compound, with the CAS number 376608-65-0, is a complex organic molecule characterized by its s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...