Compound Q&A

What are the main uses of (2R,3R)-2,3-Dihydroxysuccinic acid - 2-{[(3aR,4S,6R,6aS)-6-amino-2,2-dimethyltetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy}ethanol (1:1) (CAS: 376608-65-0)?

Answer

(2R,3R)-2,3-Dihydroxysuccinic acid - 2-{[(3aR,4S,6R,6aS)-6-amino-2,2-dimethyltetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy}ethanol (1:1)
This compound is primarily used in pharmaceutical research for the development of therapeutic agents, particularly in the context of drug design and synthesis. It may also find applications in organic chemistry as a building block for more complex molecules. Its unique structure makes it relevant in studies related to bioactive compounds and molecular interactions.

About

English Name (2R,3R)-2,3-Dihydroxysuccinic acid - 2-{[(3aR,4S,6R,6aS)-6-amino-2,2-dimethyltetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy}ethanol (1:1)
Molecular Formula C14H25NO10
Molecular Weight 367.35 g/mol
SMILES CC1(C)O[C@H]2[C@H](N)C[C@H](OCCO)[C@H]2O1.O[C@H]([C@@H](O)C(=O)O)C(=O)O
InChIKey XEYNXCGNMKWIDO-ABGQOWMBSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (2R,3R)-2,3-Dihydroxysuccinic acid - 2-{[(3aR,4S,6R,6aS)-6-amino-2,2-dimethyltetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy}ethanol (1:1) (CAS: 376608-65-0)?

This compound, with the CAS number 376608-65-0, is a complex organic molecule characterized by its s...

Compound Q&A

Is (2R,3R)-2,3-Dihydroxysuccinic acid - 2-{[(3aR,4S,6R,6aS)-6-amino-2,2-dimethyltetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy}ethanol (1:1) (CAS: 376608-65-0) safe?

The safety of this compound depends on its handling and exposure conditions. It is generally conside...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...