Compound Q&A

What are the main uses of 4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene (CAS: 461432-23-5)?

Answer

4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene
4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene is primarily used in pharmaceutical research as a building block for drug development. It also finds applications in organic chemistry for synthesizing various derivatives and in industrial processes involving halogenated compounds. Its unique structure makes it valuable in compound libraries and chemical screening studies.

About

English Name 4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene
Molecular Formula C15H14BrClO
Molecular Weight 325.63 g/mol
SMILES CCOc1ccc(cc1)Cc1cc(Br)ccc1Cl
InChIKey ZUNCHZBITMUSRD-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene (CAS: 461432-23-5)?

4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene is an organic compound with the chemical formula C15H15Br...

Compound Q&A

Is 4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene (CAS: 461432-23-5) safe?

4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene should be handled with care due to its potential toxicity...

Compound Q&A

How should 4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene (CAS: 461432-23-5) be stored?

4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene should be stored in a cool, dry, and well-ventilated area...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...