Compound Q&A

What is 4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene (CAS: 461432-23-5)?

Answer

4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene
4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene is an organic compound with the chemical formula C15H15BrClO. It contains a benzene ring substituted with bromo, chloro, and a 4-ethoxybenzyl group. This compound is known for its aromatic structure and halogenated functionalities, making it relevant in organic synthesis and chemical research.

About

English Name 4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene
Molecular Formula C15H14BrClO
Molecular Weight 325.63 g/mol
SMILES CCOc1ccc(cc1)Cc1cc(Br)ccc1Cl
InChIKey ZUNCHZBITMUSRD-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene (CAS: 461432-23-5)?

4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene is primarily used in pharmaceutical research as a buildin...

Compound Q&A

Is 4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene (CAS: 461432-23-5) safe?

4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene should be handled with care due to its potential toxicity...

Compound Q&A

How should 4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene (CAS: 461432-23-5) be stored?

4-Bromo-1-chloro-2-(4-ethoxybenzyl)benzene should be stored in a cool, dry, and well-ventilated area...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...