Compound Q&A

What are the main uses of Dicaesium carbonate (CAS: 534-17-8)?

Answer

Dicaesium carbonate
Dicaesium carbonate is primarily used in pharmaceutical research, as a source of cesium ions in analytical chemistry, and in the synthesis of various organic compounds. It also finds applications in nuclear science and materials research. Its use is limited due to its high cost and reactivity, but it plays a crucial role in specific chemical processes and experiments.

About

CAS No 534-17-8
English Name Dicaesium carbonate
Molecular Formula CCs2O3
Molecular Weight 325.82 g/mol
SMILES C(=O)([O-])[O-].[Cs+].[Cs+]
InChIKey FJDQFPXHSGXQBY-UHFFFAOYSA-L
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Dicaesium carbonate (CAS: 534-17-8)?

Dicaesium carbonate is a chemical compound with the formula Cs₂CO₃. It is a white, crystalline solid...

Compound Q&A

Is Dicaesium carbonate (CAS: 534-17-8) safe?

Dicaesium carbonate is considered hazardous due to its high reactivity and potential to cause irrita...

Compound Q&A

How should Dicaesium carbonate (CAS: 534-17-8) be stored?

Dicaesium carbonate should be stored in a cool, dry, and well-ventilated area, away from moisture an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...