Compound Q&A

What are the main uses of 4-(Hydroxymethyl)phenyl beta-D-glucopyranoside (CAS: 62499-27-8)?

Answer

4-(Hydroxymethyl)phenyl beta-D-glucopyranoside
4-(Hydroxymethyl)phenyl beta-D-glucopyranoside is primarily used in pharmaceutical and research settings. It serves as a precursor in the synthesis of various bioactive compounds and may be utilized in drug development for its potential interactions with biological systems. Additionally, it is studied for its role in carbohydrate chemistry and its applications in medicinal research.

About

CAS No 62499-27-8
English Name 4-(Hydroxymethyl)phenyl beta-D-glucopyranoside
Molecular Formula C13H18O7
Molecular Weight 286.28 g/mol
SMILES OC[C@H]1O[C@@H](OC2=CC=C(CO)C=C2)[C@H](O)[C@@H](O)[C@@H]1O
InChIKey PUQSUZTXKPLAPR-UJPOAAIJSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 4-(Hydroxymethyl)phenyl beta-D-glucopyranoside (CAS: 62499-27-8)?

4-(Hydroxymethyl)phenyl beta-D-glucopyranoside is a chemical compound with the CAS number 62499-27-8...

Compound Q&A

Is 4-(Hydroxymethyl)phenyl beta-D-glucopyranoside (CAS: 62499-27-8) safe?

4-(Hydroxymethyl)phenyl beta-D-glucopyranoside is generally considered safe when handled under prope...

Compound Q&A

How should 4-(Hydroxymethyl)phenyl beta-D-glucopyranoside (CAS: 62499-27-8) be stored?

4-(Hydroxymethyl)phenyl beta-D-glucopyranoside should be stored in a cool, dry, and dark place to ma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...