Compound Q&A

What is 4-(Hydroxymethyl)phenyl beta-D-glucopyranoside (CAS: 62499-27-8)?

Answer

4-(Hydroxymethyl)phenyl beta-D-glucopyranoside
4-(Hydroxymethyl)phenyl beta-D-glucopyranoside is a chemical compound with the CAS number 62499-27-8. It is a derivative of beta-D-glucopyranoside, which is a sugar molecule, and features a hydroxymethylphenyl group attached to the glucose ring. This compound is known for its potential applications in biochemistry and pharmaceutical research due to its structural complexity and possible biological activity.

About

CAS No 62499-27-8
English Name 4-(Hydroxymethyl)phenyl beta-D-glucopyranoside
Molecular Formula C13H18O7
Molecular Weight 286.28 g/mol
SMILES OC[C@H]1O[C@@H](OC2=CC=C(CO)C=C2)[C@H](O)[C@@H](O)[C@@H]1O
InChIKey PUQSUZTXKPLAPR-UJPOAAIJSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 4-(Hydroxymethyl)phenyl beta-D-glucopyranoside (CAS: 62499-27-8)?

4-(Hydroxymethyl)phenyl beta-D-glucopyranoside is primarily used in pharmaceutical and research sett...

Compound Q&A

Is 4-(Hydroxymethyl)phenyl beta-D-glucopyranoside (CAS: 62499-27-8) safe?

4-(Hydroxymethyl)phenyl beta-D-glucopyranoside is generally considered safe when handled under prope...

Compound Q&A

How should 4-(Hydroxymethyl)phenyl beta-D-glucopyranoside (CAS: 62499-27-8) be stored?

4-(Hydroxymethyl)phenyl beta-D-glucopyranoside should be stored in a cool, dry, and dark place to ma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...