Compound Q&A

What are the main uses of 4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride (CAS: 106261-49-8)?

Answer

4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride
4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride (CAS: 106261-49-8) is primarily used in pharmaceutical research for the development of drugs targeting central nervous system disorders. It may also serve as an intermediate in the synthesis of various chemical compounds. Its unique structure makes it valuable in medicinal chemistry for exploring new therapeutic applications.

About

English Name 4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride
Molecular Formula C13H20Cl2N2O2
Molecular Weight 307.22 g/mol
SMILES CN1CCN(CC1)CC2=CC=C(C=C2)C(=O)O.Cl.Cl
InChIKey ISHROKOWRJDOSN-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride (CAS: 106261-49-8)?

4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride (CAS: 106261-49-8) is a chemical comp...

Compound Q&A

Is 4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride (CAS: 106261-49-8) safe?

4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride (CAS: 106261-49-8) is generally consi...

Compound Q&A

How should 4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride (CAS: 106261-49-8) be stored?

4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride (CAS: 106261-49-8) should be stored i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...