Compound Q&A

What is 4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride (CAS: 106261-49-8)?

Answer

4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride
4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride (CAS: 106261-49-8) is a chemical compound commonly used in pharmaceutical research. It is a hydrochloride salt of a benzoic acid derivative with a piperazine ring. The compound has a molecular formula of C14H22N2O2·2HCl and is typically a white to off-white solid with good solubility in water. It is known for its potential applications in drug development due to its structural features that may interact with biological targets.

About

English Name 4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride
Molecular Formula C13H20Cl2N2O2
Molecular Weight 307.22 g/mol
SMILES CN1CCN(CC1)CC2=CC=C(C=C2)C(=O)O.Cl.Cl
InChIKey ISHROKOWRJDOSN-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride (CAS: 106261-49-8)?

4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride (CAS: 106261-49-8) is primarily used ...

Compound Q&A

Is 4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride (CAS: 106261-49-8) safe?

4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride (CAS: 106261-49-8) is generally consi...

Compound Q&A

How should 4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride (CAS: 106261-49-8) be stored?

4-[(4-methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride (CAS: 106261-49-8) should be stored i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...