Compound Q&A

How should Pitavastatin Calcium (CAS: 147526-32-7) be stored?

Answer

Pitavastatin Calcium
Pitavastatin Calcium should be stored in a cool, dry place away from moisture and light. It is typically kept at a temperature between 15°C to 30°C (59°F to 86°F). Ensure the container is tightly sealed to prevent exposure to air. Proper storage helps maintain its chemical stability and potency over time.

About

English Name Pitavastatin Calcium
Molecular Formula C50H46CaF2N2O8
Molecular Weight 880.9836 g/mol
SMILES C1CC1C2=NC3=CC=CC=C3C(=C2C=CC(CC(CC(=O)[O-])O)O)C4=CC=C(C=C4)F.C1CC1C2=NC3=CC=CC=C3C(=C2C=CC(CC(CC(=O)[O-])O)O)C4=CC=C(C=C4)F.[Ca+2]
InChIKey RHGYHLPFVJEAOC-FFNUKLMVSA-L
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Pitavastatin Calcium (CAS: 147526-32-7)?

Pitavastatin Calcium is a statin medication used to lower cholesterol levels. It has the chemical fo...

Compound Q&A

What are the main uses of Pitavastatin Calcium (CAS: 147526-32-7)?

Pitavastatin Calcium is primarily used in the treatment of high cholesterol and other lipid disorder...

Compound Q&A

Is Pitavastatin Calcium (CAS: 147526-32-7) safe?

Pitavastatin Calcium is generally considered safe when used as directed. However, like all medicatio...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...