Compound Q&A

How should Betulinic acid (CAS: 472-15-1) be stored?

Answer

Betulinic acid
Betulinic acid should be stored in a cool, dry, and dark place to maintain its stability and prevent degradation. It is recommended to keep it in a sealed container at a temperature below 25°C and away from moisture and light exposure. Proper storage conditions help preserve its chemical integrity and ensure safe handling during use.

About

CAS No 472-15-1
English Name Betulinic acid
Molecular Formula C30H48O3
Molecular Weight 456.7 g/mol
EINECS 207-448-8
SMILES CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]1CC[C@H]3[C@@]([C@]1(C)CC2)(C)CC[C@@H]1[C@]3(C)CC[C@@H](C1(C)C)O)C(=O)O
InChIKey QGJZLNKBHJESQX-FZFNOLFKSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Betulinic acid (CAS: 472-15-1)?

Betulinic acid is a pentacyclic triterpene compound with the chemical formula C30H50O3. It is natura...

Compound Q&A

What are the main uses of Betulinic acid (CAS: 472-15-1)?

Betulinic acid is primarily used in pharmaceutical research for its potential therapeutic applicatio...

Compound Q&A

Is Betulinic acid (CAS: 472-15-1) safe?

Betulinic acid is generally considered safe when used in appropriate amounts and under proper handli...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...