Compound Q&A

What is Betulinic acid (CAS: 472-15-1)?

Answer

Betulinic acid
Betulinic acid is a pentacyclic triterpene compound with the chemical formula C30H50O3. It is naturally found in the bark of various plants, such as birch trees, and is known for its diverse biological activities, including anti-inflammatory, antitumor, and antiviral properties. Betulinic acid is widely used in research and has potential applications in pharmaceutical and cosmetic industries due to its unique chemical structure and functional groups.

About

CAS No 472-15-1
English Name Betulinic acid
Molecular Formula C30H48O3
Molecular Weight 456.7 g/mol
EINECS 207-448-8
SMILES CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]1CC[C@H]3[C@@]([C@]1(C)CC2)(C)CC[C@@H]1[C@]3(C)CC[C@@H](C1(C)C)O)C(=O)O
InChIKey QGJZLNKBHJESQX-FZFNOLFKSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Betulinic acid (CAS: 472-15-1)?

Betulinic acid is primarily used in pharmaceutical research for its potential therapeutic applicatio...

Compound Q&A

Is Betulinic acid (CAS: 472-15-1) safe?

Betulinic acid is generally considered safe when used in appropriate amounts and under proper handli...

Compound Q&A

How should Betulinic acid (CAS: 472-15-1) be stored?

Betulinic acid should be stored in a cool, dry, and dark place to maintain its stability and prevent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...