Compound Q&A

What are the main uses of Deoxyuridine (CAS: 951-78-0)?

Answer

Deoxyuridine
Deoxyuridine (CAS: 951-78-0) is primarily utilized in pharmaceutical research for antiviral and antitumor drug development. It serves as a building block in nucleotide synthesis and is employed in DNA sequencing and genetic engineering. Additionally, it finds applications in industrial processes for nucleic acid-based products and as a nutritional supplement in certain formulations. Its role in biochemical studies makes it essential for molecular research.

About

CAS No 951-78-0
English Name Deoxyuridine
Molecular Formula C9H12N2O5
Molecular Weight 228.2 g/mol
SMILES C1C(C(OC1N2C=CC(=O)NC2=O)CO)O
InChIKey MXHRCPNRJAMMIM-SHYZEUOFSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Deoxyuridine (CAS: 951-78-0)?

Deoxyuridine (CAS: 951-78-0) is a nucleoside compound composed of the sugar deoxyribose linked to th...

Compound Q&A

Is Deoxyuridine (CAS: 951-78-0) safe?

Deoxyuridine (CAS: 951-78-0) is generally considered safe when handled properly in controlled enviro...

Compound Q&A

How should Deoxyuridine (CAS: 951-78-0) be stored?

Deoxyuridine (CAS: 951-78-0) should be stored in a cool, dry place, away from light, in airtight con...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...