Related Q&A
What is N4-(7-Chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine phosphate (1:2) (CAS: 50-63-5)?
N4-(7-Chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine phosphate (1:2) is a phosphate ester der...
Is N4-(7-Chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine phosphate (1:2) (CAS: 50-63-5) safe?
Safety of this compound depends on proper handling. While it is generally considered low in acute to...
How should N4-(7-Chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine phosphate (1:2) (CAS: 50-63-5) be stored?
Store this compound at room temperature (15-25°C) in a dry, airtight container to prevent moisture a...
What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?
6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...
What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?
4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...
What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?
2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...
What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?
2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

