What are the main uses of N4-(7-Chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine phosphate (1:2) (CAS: 50-63-5)?

This compound is primarily used in pharmaceutical research as a precursor for drug development, particularly in compounds targeting neurological or metabolic pathways. It also serves as a key intermediate in organic synthesis and may find applications in industrial processes requiring phosphate ester functionality. Its unique structure supports use in chemical research and specialty chemical manufacturing, with CAS number 50-63-5 ensuring traceability.