Compound Q&A

What is N4-(7-Chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine phosphate (1:2) (CAS: 50-63-5)?

Answer

N~4~-(7-Chloro-4-quinolinyl)-N~1~,N~1~-diethyl-1,4-pentanediamine phosphate (1:2)
N4-(7-Chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine phosphate (1:2) is a phosphate ester derived from 1,4-pentanediamine and 7-chloro-4-quinolinyl groups. It has the chemical formula C16H22ClN3O11P2 and is characterized by its polar phosphate functionality and quinoline-based structure, making it useful in specialized chemical applications. Its CAS number is 50-63-5, ensuring accurate identification in research and industry contexts.

About

CAS No 50-63-5
English Name N~4~-(7-Chloro-4-quinolinyl)-N~1~,N~1~-diethyl-1,4-pentanediamine phosphate (1:2)
Molecular Formula C18H32ClN3O8P2
Molecular Weight 515.87 g/mol
SMILES CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12.OP(=O)(O)O.OP(=O)(O)O
InChIKey QKICWELGRMTQCR-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of N4-(7-Chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine phosphate (1:2) (CAS: 50-63-5)?

This compound is primarily used in pharmaceutical research as a precursor for drug development, part...

Compound Q&A

Is N4-(7-Chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine phosphate (1:2) (CAS: 50-63-5) safe?

Safety of this compound depends on proper handling. While it is generally considered low in acute to...

Compound Q&A

How should N4-(7-Chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine phosphate (1:2) (CAS: 50-63-5) be stored?

Store this compound at room temperature (15-25°C) in a dry, airtight container to prevent moisture a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...