Compound Q&A

How should {(5Z)-5-[(2E)-2-Methyl-3-phenyl-2-propen-1-ylidene]-4-oxo-2-thioxo-1,3-thiazolidin-3-yl}acetic acid (CAS: 82159-09-9) be stored?

Answer

{(5Z)-5-[(2E)-2-Methyl-3-phenyl-2-propen-1-ylidene]-4-oxo-2-thioxo-1,3-thiazolidin-3-yl}acetic acid
This compound should be stored in a cool, dry, and dark place, ideally at 2-8°C. It is best kept in a sealed container away from moisture and light to maintain stability and prevent degradation. Always store in a well-ventilated area to avoid exposure risks.

About

CAS No 82159-09-9
English Name {(5Z)-5-[(2E)-2-Methyl-3-phenyl-2-propen-1-ylidene]-4-oxo-2-thioxo-1,3-thiazolidin-3-yl}acetic acid
Molecular Formula C15H13NO3S2
Molecular Weight 319.41 g/mol
SMILES CC(=CC1=CC=CC=C1)C=C2C(=O)N(C(=S)S2)CC(=O)O
InChIKey CHNUOJQWGUIOLD-NFZZJPOKSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is {(5Z)-5-[(2E)-2-Methyl-3-phenyl-2-propen-1-ylidene]-4-oxo-2-thioxo-1,3-thiazolidin-3-yl}acetic acid (CAS: 82159-09-9)?

This compound, with the CAS number 82159-09-9, is a complex organic molecule containing a thiazolidi...

Compound Q&A

What are the main uses of {(5Z)-5-[(2E)-2-Methyl-3-phenyl-2-propen-1-ylidene]-4-oxo-2-thioxo-1,3-thiazolidin-3-yl}acetic acid (CAS: 82159-09-9)?

It is primarily used in pharmaceutical research for potential therapeutic applications, including as...

Compound Q&A

Is {(5Z)-5-[(2E)-2-Methyl-3-phenyl-2-propen-1-ylidene]-4-oxo-2-thioxo-1,3-thiazolidin-3-yl}acetic acid (CAS: 82159-09-9) safe?

As a chemical compound, it requires careful handling due to its potential reactivity. Safety measure...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...