Compound Q&A

What are the main uses of {(5Z)-5-[(2E)-2-Methyl-3-phenyl-2-propen-1-ylidene]-4-oxo-2-thioxo-1,3-thiazolidin-3-yl}acetic acid (CAS: 82159-09-9)?

Answer

{(5Z)-5-[(2E)-2-Methyl-3-phenyl-2-propen-1-ylidene]-4-oxo-2-thioxo-1,3-thiazolidin-3-yl}acetic acid
It is primarily used in pharmaceutical research for potential therapeutic applications, including as a precursor in the synthesis of drugs targeting inflammation and oxidative stress. Its unique structure also makes it relevant in organic chemistry for studying reaction mechanisms and molecular interactions.

About

CAS No 82159-09-9
English Name {(5Z)-5-[(2E)-2-Methyl-3-phenyl-2-propen-1-ylidene]-4-oxo-2-thioxo-1,3-thiazolidin-3-yl}acetic acid
Molecular Formula C15H13NO3S2
Molecular Weight 319.41 g/mol
SMILES CC(=CC1=CC=CC=C1)C=C2C(=O)N(C(=S)S2)CC(=O)O
InChIKey CHNUOJQWGUIOLD-NFZZJPOKSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is {(5Z)-5-[(2E)-2-Methyl-3-phenyl-2-propen-1-ylidene]-4-oxo-2-thioxo-1,3-thiazolidin-3-yl}acetic acid (CAS: 82159-09-9)?

This compound, with the CAS number 82159-09-9, is a complex organic molecule containing a thiazolidi...

Compound Q&A

Is {(5Z)-5-[(2E)-2-Methyl-3-phenyl-2-propen-1-ylidene]-4-oxo-2-thioxo-1,3-thiazolidin-3-yl}acetic acid (CAS: 82159-09-9) safe?

As a chemical compound, it requires careful handling due to its potential reactivity. Safety measure...

Compound Q&A

How should {(5Z)-5-[(2E)-2-Methyl-3-phenyl-2-propen-1-ylidene]-4-oxo-2-thioxo-1,3-thiazolidin-3-yl}acetic acid (CAS: 82159-09-9) be stored?

This compound should be stored in a cool, dry, and dark place, ideally at 2-8°C. It is best kept in ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...