Compound Q&A

What are the main uses of Diethyl (2R,3R)-2,3-dihydroxysuccinate (CAS: 87-91-2)?

Answer

Diethyl (2R,3R)-2,3-dihydroxysuccinate
Diethyl (2R,3R)-2,3-dihydroxysuccinate is primarily used in pharmaceutical research for the synthesis of drugs and as a chiral auxiliary. It also finds applications in organic chemistry for creating enantiomerically pure compounds. Additionally, it is used in the production of certain specialty chemicals and in research related to metabolic studies and enzyme inhibition.

About

CAS No 87-91-2
English Name Diethyl (2R,3R)-2,3-dihydroxysuccinate
Molecular Formula C8H14O6
Molecular Weight 206.19399999999996 g/mol
SMILES CCOC(=O)[C@H](O)[C@@H](O)C(=O)OCC
InChIKey YSAVZVORKRDODB-PHDIDXHHSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Diethyl (2R,3R)-2,3-dihydroxysuccinate (CAS: 87-91-2)?

Diethyl (2R,3R)-2,3-dihydroxysuccinate is a chiral compound with the chemical formula C8H16O6. It is...

Compound Q&A

Is Diethyl (2R,3R)-2,3-dihydroxysuccinate (CAS: 87-91-2) safe?

Diethyl (2R,3R)-2,3-dihydroxysuccinate is generally considered safe when handled properly. However, ...

Compound Q&A

How should Diethyl (2R,3R)-2,3-dihydroxysuccinate (CAS: 87-91-2) be stored?

Diethyl (2R,3R)-2,3-dihydroxysuccinate should be stored in a cool, dry place away from light. It is ...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...