Compound Q&A

What is Diethyl (2R,3R)-2,3-dihydroxysuccinate (CAS: 87-91-2)?

Answer

Diethyl (2R,3R)-2,3-dihydroxysuccinate
Diethyl (2R,3R)-2,3-dihydroxysuccinate is a chiral compound with the chemical formula C8H16O6. It is characterized by its two hydroxyl groups on the succinate backbone and is commonly used as a pharmaceutical intermediate. The compound is known for its stability and solubility in polar solvents, making it suitable for various chemical applications.

About

CAS No 87-91-2
English Name Diethyl (2R,3R)-2,3-dihydroxysuccinate
Molecular Formula C8H14O6
Molecular Weight 206.19399999999996 g/mol
SMILES CCOC(=O)[C@H](O)[C@@H](O)C(=O)OCC
InChIKey YSAVZVORKRDODB-PHDIDXHHSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Diethyl (2R,3R)-2,3-dihydroxysuccinate (CAS: 87-91-2)?

Diethyl (2R,3R)-2,3-dihydroxysuccinate is primarily used in pharmaceutical research for the synthesi...

Compound Q&A

Is Diethyl (2R,3R)-2,3-dihydroxysuccinate (CAS: 87-91-2) safe?

Diethyl (2R,3R)-2,3-dihydroxysuccinate is generally considered safe when handled properly. However, ...

Compound Q&A

How should Diethyl (2R,3R)-2,3-dihydroxysuccinate (CAS: 87-91-2) be stored?

Diethyl (2R,3R)-2,3-dihydroxysuccinate should be stored in a cool, dry place away from light. It is ...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...