Compound Q&A

What are the main uses of 1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone (CAS: 86404-63-9)?

Answer

1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone
1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone (CAS: 86404-63-9) is primarily used in pharmaceutical development as a key intermediate in the synthesis of various drug compounds. It also finds applications in organic chemistry research, and may be utilized in industrial processes for the production of specialized chemicals. Its unique structure makes it valuable in the development of compounds with potential therapeutic properties.

About

CAS No 86404-63-9
English Name 1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone
Molecular Formula C10H7F2N3O
Molecular Weight 223.18 g/mol
SMILES Fc1ccc(C(=O)Cn2cncn2)c(F)c1
InChIKey XCHRPVARHBCFMJ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone (CAS: 86404-63-9)?

1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone is a synthetic organic compound with the CA...

Compound Q&A

Is 1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone (CAS: 86404-63-9) safe?

1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone (CAS: 86404-63-9) is generally considered s...

Compound Q&A

How should 1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone (CAS: 86404-63-9) be stored?

1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone (CAS: 86404-63-9) should be stored in a coo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...