Compound Q&A

What is 1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone (CAS: 86404-63-9)?

Answer

1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone
1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone is a synthetic organic compound with the CAS number 86404-63-9. It is characterized by its ethanone backbone substituted with a 2,4-difluorophenyl group and a 1H-1,2,4-triazol-1-yl ring. This compound is known for its stability and is commonly used in chemical synthesis, particularly in pharmaceutical research due to its potential biological activity.

About

CAS No 86404-63-9
English Name 1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone
Molecular Formula C10H7F2N3O
Molecular Weight 223.18 g/mol
SMILES Fc1ccc(C(=O)Cn2cncn2)c(F)c1
InChIKey XCHRPVARHBCFMJ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone (CAS: 86404-63-9)?

1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone (CAS: 86404-63-9) is primarily used in phar...

Compound Q&A

Is 1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone (CAS: 86404-63-9) safe?

1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone (CAS: 86404-63-9) is generally considered s...

Compound Q&A

How should 1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone (CAS: 86404-63-9) be stored?

1-(2,4-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone (CAS: 86404-63-9) should be stored in a coo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...