Compound Q&A

How should Dapoxetine Hydrochloride (CAS: 129938-20-1) be stored?

Answer

Dapoxetine Hydrochloride
Dapoxetine Hydrochloride (CAS: 129938-20-1) should be stored in a cool, dry place (ideally 25°C), away from moisture and direct light. Keep in a sealed, airtight container to maintain stability and prevent degradation. Storage precautions include avoiding exposure to high humidity and ensuring it is kept in a secure location to prevent unauthorized access or misuse.

About

English Name Dapoxetine Hydrochloride
Molecular Formula C21H24ClNO
Molecular Weight 341.9 g/mol
SMILES CN(C)C(CCOC1=CC=CC2=CC=CC=C21)C3=CC=CC=C3.Cl
InChIKey IHWDIQRWYNMKFM-BDQAORGHSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Dapoxetine Hydrochloride (CAS: 129938-20-1)?

Dapoxetine Hydrochloride (CAS: 129938-20-1) is a selective serotonin reuptake inhibitor (SSRI) prima...

Compound Q&A

What are the main uses of Dapoxetine Hydrochloride (CAS: 129938-20-1)?

Dapoxetine Hydrochloride (CAS: 129938-20-1) is mainly used as a medication for the treatment of prem...

Compound Q&A

Is Dapoxetine Hydrochloride (CAS: 129938-20-1) safe?

Dapoxetine Hydrochloride (CAS: 129938-20-1) is considered safe when used as prescribed, with a well-...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...