Compound Q&A

What is Lapatinib (CAS: 231277-92-2)?

Answer

Lapatinib
Lapatinib is a small molecule kinase inhibitor with the chemical formula C22H26N2O2S. It is known for its ability to inhibit the epidermal growth factor receptor (EGFR) and human epidermal growth factor receptor 2 (HER2), making it a valuable compound in cancer research and treatment. Its molecular weight is approximately 382.5 g/mol and it is typically a white to off-white solid at room temperature.

About

English Name Lapatinib
Molecular Formula C29H26ClFN4O4S
Molecular Weight 581.07 g/mol
SMILES CS(=O)(=O)CCNCC1=CC=C(O1)C2=CC3=C(C=C2)N=CN=C3NC4=CC(=C(C=C4)OCC5=CC(=CC=C5)F)Cl
InChIKey BCFGMOOMADDAQU-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Lapatinib (CAS: 231277-92-2)?

Lapatinib is primarily used in the treatment of certain types of breast cancer, particularly those t...

Compound Q&A

Is Lapatinib (CAS: 231277-92-2) safe?

Lapatinib is generally considered safe when used under medical supervision for its intended therapeu...

Compound Q&A

How should Lapatinib (CAS: 231277-92-2) be stored?

Lapatinib should be stored in a cool, dry, and dark place, preferably at a temperature between 15°C ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...