Compound Q&A

What are the main uses of (1S)-1,5-Anhydro-1-(3-{[5-(4-fluorophenyl)-2-thienyl]methyl}-4-methylphenyl)-D-glucitol (CAS: 842133-18-0)?

Answer

(1S)-1,5-Anhydro-1-(3-{[5-(4-fluorophenyl)-2-thienyl]methyl}-4-methylphenyl)-D-glucitol
This compound is mainly used in the pharmaceutical industry for the development of drugs targeting specific biological pathways. It also finds application in chemical research for the synthesis of more complex molecules and in the study of carbohydrate derivatives. Its utility is further extended to industrial processes that require precise chemical intermediates.

About

English Name (1S)-1,5-Anhydro-1-(3-{[5-(4-fluorophenyl)-2-thienyl]methyl}-4-methylphenyl)-D-glucitol
Molecular Formula C24H25FO5S
Molecular Weight 444.52 g/mol
SMILES Cc1ccc(cc1Cc2ccc(s2)c3ccc(cc3)F)[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O
InChIKey XTNGUQKDFGDXSJ-ZXGKGEBGSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is (1S)-1,5-Anhydro-1-(3-{[5-(4-fluorophenyl)-2-thienyl]methyl}-4-methylphenyl)-D-glucitol (CAS: 842133-18-0)?

This compound is a derivative of D-glucitol, characterized by its complex structure featuring a 4-fl...

Compound Q&A

Is (1S)-1,5-Anhydro-1-(3-{[5-(4-fluorophenyl)-2-thienyl]methyl}-4-methylphenyl)-D-glucitol (CAS: 842133-18-0) safe?

As a research chemical, this compound is generally considered safe when handled according to standar...

Compound Q&A

How should (1S)-1,5-Anhydro-1-(3-{[5-(4-fluorophenyl)-2-thienyl]methyl}-4-methylphenyl)-D-glucitol (CAS: 842133-18-0) be stored?

This compound should be stored in a cool, dry, and dark place, ideally at 2-8°C. It is best kept in ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...