Compound Q&A

What are the main uses of Cefotaxime sodium (CAS: 64485-93-4)?

Answer

Cefotaxime sodium
Cefotaxime sodium is primarily used in the treatment of severe bacterial infections such as pneumonia, urinary tract infections, and skin infections. It is also employed in hospital settings for infections caused by resistant bacteria. Additionally, it serves as a research compound for studying antibiotic mechanisms and developing new therapeutic strategies.

About

CAS No 64485-93-4
English Name Cefotaxime sodium
Molecular Formula C16H16N5NaO7S2
Molecular Weight 477.5 g/mol
SMILES CC(=O)OCC1=C(N2C(C(C2=O)NC(=O)C(=NOC)C3=CSC(=N3)N)SC1)C(=O)[O-].[Na+]
InChIKey AZZMGZXNTDTSME-JUZDKLSSSA-M
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is Cefotaxime sodium (CAS: 64485-93-4)?

Cefotaxime sodium is a third-generation cephalosporin antibiotic used to treat a variety of bacteria...

Compound Q&A

Is Cefotaxime sodium (CAS: 64485-93-4) safe?

Cefotaxime sodium is generally considered safe when used as directed. However, it may cause side eff...

Compound Q&A

How should Cefotaxime sodium (CAS: 64485-93-4) be stored?

Cefotaxime sodium should be stored in a cool, dry place away from light. It is typically kept at a t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...