Compound Q&A

What are the main uses of 3,5-dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid (CAS: 90045-36-6)?

Answer

Azane;3,5-dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid
3,5-Dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid (CAS: 90045-36-6) is primarily used in pharmaceutical research as a building block for synthesizing drugs with specific biological activities. It may also find applications in organic chemistry for the development of other functional compounds. Its unique structure makes it valuable in the design of molecules with potential therapeutic or industrial uses.

About

CAS No 90045-36-6
English Name Azane;3,5-dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid
Molecular Formula C8H9NO4S
Molecular Weight 215.23 g/mol
EINECS 289-896-4
SMILES C1=CC=C(C=C1)N2C(=NN=N2)SC3=C(C=C(C=C3[N+](=O)[O-])C(=O)O)[N+](=O)[O-].N
InChIKey SROHFTOYGFCJAF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 3,5-dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid (CAS: 90045-36-6)?

3,5-Dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid (CAS: 90045-36-6) is an organic compound c...

Compound Q&A

Is 3,5-dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid (CAS: 90045-36-6) safe?

3,5-Dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid (CAS: 90045-36-6) should be handled with c...

Compound Q&A

How should 3,5-dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid (CAS: 90045-36-6) be stored?

3,5-Dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid (CAS: 90045-36-6) should be stored in a co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...