Compound Q&A

What is 3,5-dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid (CAS: 90045-36-6)?

Answer

Azane;3,5-dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid
3,5-Dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid (CAS: 90045-36-6) is an organic compound containing a sulfanyl group, a benzene ring, and a 1-phenyltetrazol-5-yl substituent. It is known for its nitro and sulfanyl functionalities, which contribute to its reactivity and potential applications in chemical synthesis. This compound is typically used as an intermediate in the development of pharmaceuticals and other specialized chemical products.

About

CAS No 90045-36-6
English Name Azane;3,5-dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid
Molecular Formula C8H9NO4S
Molecular Weight 215.23 g/mol
EINECS 289-896-4
SMILES C1=CC=C(C=C1)N2C(=NN=N2)SC3=C(C=C(C=C3[N+](=O)[O-])C(=O)O)[N+](=O)[O-].N
InChIKey SROHFTOYGFCJAF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 3,5-dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid (CAS: 90045-36-6)?

3,5-Dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid (CAS: 90045-36-6) is primarily used in pha...

Compound Q&A

Is 3,5-dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid (CAS: 90045-36-6) safe?

3,5-Dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid (CAS: 90045-36-6) should be handled with c...

Compound Q&A

How should 3,5-dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid (CAS: 90045-36-6) be stored?

3,5-Dinitro-4-(1-phenyltetrazol-5-yl)sulfanylbenzoic acid (CAS: 90045-36-6) should be stored in a co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...