Compound Q&A

What is Disodium 1,6-naphthalenedisulfonate (CAS: 1655-43-2)?

Answer

Disodium 1,6-naphthalenedisulfonate
Disodium 1,6-naphthalenedisulfonate (CAS: 1655-43-2) is an inorganic sodium salt with the chemical formula C10H6Na2O6S2. It is a white, crystalline solid commonly used in chemical synthesis. This compound exhibits good water solubility and is known for its stability under normal conditions. Its structure includes two sulfonate groups attached to a naphthalene ring, making it a versatile intermediate in various industrial applications.

About

CAS No 1655-43-2
English Name Disodium 1,6-naphthalenedisulfonate
Molecular Formula C10H6Na2O6S2
Molecular Weight 332.3 g/mol
SMILES C1=CC2=C(C=CC(=C2)S(=O)(=O)[O-])C(=C1)S(=O)(=O)[O-].[Na+].[Na+]
InChIKey FXJFYEOXUWERCL-UHFFFAOYSA-L
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Disodium 1,6-naphthalenedisulfonate (CAS: 1655-43-2)?

Disodium 1,6-naphthalenedisulfonate (CAS: 1655-43-2) is primarily used in the production of dyes, ph...

Compound Q&A

Is Disodium 1,6-naphthalenedisulfonate (CAS: 1655-43-2) safe?

Disodium 1,6-naphthalenedisulfonate (CAS: 1655-43-2) is generally considered safe when handled prope...

Compound Q&A

How should Disodium 1,6-naphthalenedisulfonate (CAS: 1655-43-2) be stored?

Disodium 1,6-naphthalenedisulfonate (CAS: 1655-43-2) should be stored in a cool, dry place, away fro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...