Compound Q&A

What are the main uses of Triphenyltin Chloride (CAS: 639-58-7)?

Answer

Triphenyltin Chloride
Triphenyltin Chloride is primarily used in pharmaceutical research as a reagent for synthesizing organic compounds. It also finds applications in industrial processes, such as polymer stabilization, and in the development of agrochemicals. Additionally, it is utilized in laboratory settings for studying organotin chemistry and its interactions with other substances.

About

CAS No 639-58-7
English Name Triphenyltin Chloride
Molecular Formula C18H15ClSn
Molecular Weight 385.48 g/mol
SMILES C1=CC=C(C=C1)[Sn](C2=CC=CC=C2)(C3=CC=CC=C3)Cl
InChIKey NJVOZLGKTAPUTQ-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is Triphenyltin Chloride (CAS: 639-58-7)?

Triphenyltin Chloride is an organotin compound with the chemical formula (C6H5)3SnCl. It appears as ...

Compound Q&A

Is Triphenyltin Chloride (CAS: 639-58-7) safe?

Triphenyltin Chloride is considered hazardous due to its potential toxicity to humans and the enviro...

Compound Q&A

How should Triphenyltin Chloride (CAS: 639-58-7) be stored?

Triphenyltin Chloride should be stored in a cool, dry, and well-ventilated area, away from light and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...