Compound Q&A

What is Triphenyltin Chloride (CAS: 639-58-7)?

Answer

Triphenyltin Chloride
Triphenyltin Chloride is an organotin compound with the chemical formula (C6H5)3SnCl. It appears as a white crystalline solid and is known for its stability in organic solvents. This compound is characterized by its tin-chloride functional group and is commonly used in chemical synthesis and research applications due to its reactivity and unique properties.

About

CAS No 639-58-7
English Name Triphenyltin Chloride
Molecular Formula C18H15ClSn
Molecular Weight 385.48 g/mol
SMILES C1=CC=C(C=C1)[Sn](C2=CC=CC=C2)(C3=CC=CC=C3)Cl
InChIKey NJVOZLGKTAPUTQ-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Triphenyltin Chloride (CAS: 639-58-7)?

Triphenyltin Chloride is primarily used in pharmaceutical research as a reagent for synthesizing org...

Compound Q&A

Is Triphenyltin Chloride (CAS: 639-58-7) safe?

Triphenyltin Chloride is considered hazardous due to its potential toxicity to humans and the enviro...

Compound Q&A

How should Triphenyltin Chloride (CAS: 639-58-7) be stored?

Triphenyltin Chloride should be stored in a cool, dry, and well-ventilated area, away from light and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...