Compound Q&A

What is Triphenyltin Chloride (CAS: 639-58-7)?

Answer

Triphenyltin Chloride
Triphenyltin Chloride is an organotin compound with the chemical formula (C6H5)3SnCl. It appears as a white crystalline solid and is known for its stability in organic solvents. This compound is characterized by its tin-chloride functional group and is commonly used in chemical synthesis and research applications due to its reactivity and unique properties.

About

CAS No 639-58-7
English Name Triphenyltin Chloride
Molecular Formula C18H15ClSn
Molecular Weight 385.4820000000001 g/mol
SMILES C1=CC=C(C=C1)[Sn](C2=CC=CC=C2)(C3=CC=CC=C3)Cl
InChIKey NJVOZLGKTAPUTQ-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Triphenyltin Chloride (CAS: 639-58-7)?

Triphenyltin Chloride is primarily used in pharmaceutical research as a reagent for synthesizing org...

Compound Q&A

Is Triphenyltin Chloride (CAS: 639-58-7) safe?

Triphenyltin Chloride is considered hazardous due to its potential toxicity to humans and the enviro...

Compound Q&A

How should Triphenyltin Chloride (CAS: 639-58-7) be stored?

Triphenyltin Chloride should be stored in a cool, dry, and well-ventilated area, away from light and...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...