Compound Q&A

What are the main uses of (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 26250-84-0)?

Answer

(2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid
This compound is primarily used in pharmaceutical research as a building block for the synthesis of various drugs. It also finds applications in chemical manufacturing and as a reagent in organic chemistry experiments. Its unique structure makes it suitable for targeted modifications in drug development, contributing to the creation of compounds with specific biological activities.

About

CAS No 26250-84-0
English Name (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid
Molecular Formula C11H19NO4
Molecular Weight 229.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCCCC1C(=O)O
InChIKey JQAOHGMPAAWWQO-QMMMGPOBSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 26250-84-0)?

This compound, with the CAS number 26250-84-0, is a derivative of piperidinecarboxylic acid. It feat...

Compound Q&A

Is (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 26250-84-0) safe?

The safety of this compound depends on exposure conditions. It is generally considered safe when han...

Compound Q&A

How should (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-piperidinecarboxylic acid (CAS: 26250-84-0) be stored?

This compound should be stored in a cool, dry, and dark place, ideally at 2-8°C. It is best kept in ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...